About bis((4-tert-butylphenyl)-diphenylsulfanium);ethane-1,2-disulfonate
bis((4-tert-butylphenyl)-diphenylsulfanium);ethane-1,2-disulfonate (PubChem CID 87387774) has the molecular formula C46H50O6S4
and a molecular weight of 827.17 g/mol. Its IUPAC name is bis((4-tert-butylphenyl)-diphenylsulfanium);ethane-1,2-disulfonate.
Molecular Properties
| Compound Name | bis((4-tert-butylphenyl)-diphenylsulfanium);ethane-1,2-disulfonate |
| PubChem CID | 87387774 |
| Molecular Formula | C46H50O6S4 |
| Molecular Weight | 827.17 g/mol |
| Exact Mass | 826.25 |
| IUPAC Name | bis((4-tert-butylphenyl)-diphenylsulfanium);ethane-1,2-disulfonate |
| SMILES | CC(C)(C)c1ccc([S+](c2ccccc2)c2ccccc2)cc1.CC(C)(C)c1ccc([S+](c2ccccc2)c2ccccc2)cc1.O=S(=O)([O-])CCS(=O)(=O)[O-] |
| InChI | InChI=1S/2C22H23S.C2H6O6S2/c2*1-22(2,3)18-14-16-21(17-15-18)23(19-10-6-4-7-11-19)20-12-8-5-9-13-20;3-9(4,5)1-2-10(6,7)8/h2*4-17H,1-3H3;1-2H2,(H,3,4,5)(H,6,7,8)/q2*+1;/p-2 |
| InChIKey | BAPOANWQRQAPJV-UHFFFAOYSA-L |
| XLogP | 10.24 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 56 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 827.17 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze bis((4-tert-butylphenyl)-diphenylsulfanium);ethane-1,2-disulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((4-tert-butylphenyl)-diphenylsulfanium);ethane-1,2-disulfonate?
The IUPAC name of bis((4-tert-butylphenyl)-diphenylsulfanium);ethane-1,2-disulfonate (CID 87387774) is bis((4-tert-butylphenyl)-diphenylsulfanium);ethane-1,2-disulfonate.
What is the SMILES notation for bis((4-tert-butylphenyl)-diphenylsulfanium);ethane-1,2-disulfonate?
The canonical SMILES for bis((4-tert-butylphenyl)-diphenylsulfanium);ethane-1,2-disulfonate is CC(C)(C)c1ccc([S+](c2ccccc2)c2ccccc2)cc1.CC(C)(C)c1ccc([S+](c2ccccc2)c2ccccc2)cc1.O=S(=O)([O-])CCS(=O)(=O)[O-].
What is the InChIKey of bis((4-tert-butylphenyl)-diphenylsulfanium);ethane-1,2-disulfonate?
The InChIKey is BAPOANWQRQAPJV-UHFFFAOYSA-L. The full InChI is InChI=1S/2C22H23S.C2H6O6S2/c2*1-22(2,3)18-14-16-21(17-15-18)23(19-10-6-4-7-11-19)20-12-8-5-9-13-20;3-9(4,5)1-2-10(6,7)8/h2*4-17H,1-3H3;1-2H2,(H,3,4,5)(H,6,7,8)/q2*+1;/p-2.
What are the key properties of bis((4-tert-butylphenyl)-diphenylsulfanium);ethane-1,2-disulfonate?
bis((4-tert-butylphenyl)-diphenylsulfanium);ethane-1,2-disulfonate has a molecular weight of 827.17 g/mol, XLogP of 10.24, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis((4-tert-butylphenyl)-diphenylsulfanium);ethane-1,2-disulfonate is sourced from PubChem (CID 87387774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).