C25H26F6O8S4 — CID 87388033
1,1,2,2,3,3-hexafluoropropane-1,3-disulfonate;bis(phenyl(thiolan-1-ium-1-yl)methanone) (PubChem CID 87388033) has the molecular formula C25H26F6O8S4 and a molecular weight of 696.73 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoropropane-1,3-disulfonate;bis(phenyl(thiolan-1-ium-1-yl)methanone).
| Compound Name | 1,1,2,2,3,3-hexafluoropropane-1,3-disulfonate;bis(phenyl(thiolan-1-ium-1-yl)methanone) |
|---|---|
| PubChem CID | 87388033 |
| Molecular Formula | C25H26F6O8S4 |
| Molecular Weight | 696.73 g/mol |
| Exact Mass | 696.04 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoropropane-1,3-disulfonate;bis(phenyl(thiolan-1-ium-1-yl)methanone) |
| SMILES | O=C(c1ccccc1)[S+]1CCCC1.O=C(c1ccccc1)[S+]1CCCC1.O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/2C11H13OS.C3H2F6O6S2/c2*12-11(13-8-4-5-9-13)10-6-2-1-3-7-10;4-1(5,2(6,7)16(10,11)12)3(8,9)17(13,14)15/h2*1-3,6-7H,4-5,8-9H2;(H,10,11,12)(H,13,14,15)/q2*+1;/p-2 |
| InChIKey | KFEKUHUMHKELGD-UHFFFAOYSA-L |
| XLogP | 4.38 |
| TPSA | 148.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.73 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|