C20H25O3P — CID 87388233
6-hydroxy-2-(2,4,4-trimethylpentan-2-yl)benzo[c][2,1]benzoxaphosphinine 6-oxide (PubChem CID 87388233) has the molecular formula C20H25O3P and a molecular weight of 344.39 g/mol. Its IUPAC name is 6-hydroxy-2-(2,4,4-trimethylpentan-2-yl)benzo[c][2,1]benzoxaphosphinine 6-oxide.
| Compound Name | 6-hydroxy-2-(2,4,4-trimethylpentan-2-yl)benzo[c][2,1]benzoxaphosphinine 6-oxide |
|---|---|
| PubChem CID | 87388233 |
| Molecular Formula | C20H25O3P |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 6-hydroxy-2-(2,4,4-trimethylpentan-2-yl)benzo[c][2,1]benzoxaphosphinine 6-oxide |
| SMILES | CC(C)(C)CC(C)(C)c1ccc2c(c1)-c1ccccc1P(=O)(O)O2 |
| InChI | InChI=1S/C20H25O3P/c1-19(2,3)13-20(4,5)14-10-11-17-16(12-14)15-8-6-7-9-18(15)24(21,22)23-17/h6-12H,13H2,1-5H3,(H,21,22) |
| InChIKey | LCHCKCRGYZPPRG-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|