C73H94F8O9S3 — CID 87388271
bis(bis(4-octoxyphenyl)-phenylsulfanium);2,2,3,3,4,4,5,5-octafluoro-5-sulfonatopentanoate (PubChem CID 87388271) has the molecular formula C73H94F8O9S3 and a molecular weight of 1363.73 g/mol. Its IUPAC name is bis(bis(4-octoxyphenyl)-phenylsulfanium);2,2,3,3,4,4,5,5-octafluoro-5-sulfonatopentanoate.
| Compound Name | bis(bis(4-octoxyphenyl)-phenylsulfanium);2,2,3,3,4,4,5,5-octafluoro-5-sulfonatopentanoate |
|---|---|
| PubChem CID | 87388271 |
| Molecular Formula | C73H94F8O9S3 |
| Molecular Weight | 1363.73 g/mol |
| Exact Mass | 1362.59 |
| IUPAC Name | bis(bis(4-octoxyphenyl)-phenylsulfanium);2,2,3,3,4,4,5,5-octafluoro-5-sulfonatopentanoate |
| SMILES | CCCCCCCCOc1ccc([S+](c2ccccc2)c2ccc(OCCCCCCCC)cc2)cc1.CCCCCCCCOc1ccc([S+](c2ccccc2)c2ccc(OCCCCCCCC)cc2)cc1.O=C([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/2C34H47O2S.C5H2F8O5S/c2*1-3-5-7-9-11-16-28-35-30-20-24-33(25-21-30)37(32-18-14-13-15-19-32)34-26-22-31(23-27-34)36-29-17-12-10-8-6-4-2;6-2(7,1(14)15)3(8,9)4(10,11)5(12,13)19(16,17)18/h2*13-15,18-27H,3-12,16-17,28-29H2,1-2H3;(H,14,15)(H,16,17,18)/q2*+1;/p-2 |
| InChIKey | UTJTVSFDJAKAJF-UHFFFAOYSA-L |
| XLogP | 20.30 |
| TPSA | 134.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 93 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1363.73 |
| LogP ≤ 5 | 20.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|