About 8H-indeno[1,2-d][1,3]thiazole
8H-indeno[1,2-d][1,3]thiazole (PubChem CID 87388293) has the molecular formula C10H7NS
and a molecular weight of 173.24 g/mol. Its IUPAC name is 8H-indeno[1,2-d][1,3]thiazole.
Molecular Properties
| Compound Name | 8H-indeno[1,2-d][1,3]thiazole |
| PubChem CID | 87388293 |
| Molecular Formula | C10H7NS |
| Molecular Weight | 173.24 g/mol |
| Exact Mass | 173.03 |
| IUPAC Name | 8H-indeno[1,2-d][1,3]thiazole |
| SMILES | C1=CCC2=c3ncsc3=CC2=C1 |
| InChI | InChI=1S/C10H7NS/c1-2-4-8-7(3-1)5-9-10(8)11-6-12-9/h1-3,5-6H,4H2 |
| InChIKey | ZFVIEJPTZRNFMN-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.24 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8H-indeno[1,2-d][1,3]thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8H-indeno[1,2-d][1,3]thiazole?
The IUPAC name of 8H-indeno[1,2-d][1,3]thiazole (CID 87388293) is 8H-indeno[1,2-d][1,3]thiazole.
What is the SMILES notation for 8H-indeno[1,2-d][1,3]thiazole?
The canonical SMILES for 8H-indeno[1,2-d][1,3]thiazole is C1=CCC2=c3ncsc3=CC2=C1.
What is the InChIKey of 8H-indeno[1,2-d][1,3]thiazole?
The InChIKey is ZFVIEJPTZRNFMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NS/c1-2-4-8-7(3-1)5-9-10(8)11-6-12-9/h1-3,5-6H,4H2.
What are the key properties of 8H-indeno[1,2-d][1,3]thiazole?
8H-indeno[1,2-d][1,3]thiazole has a molecular weight of 173.24 g/mol, XLogP of 0.97, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8H-indeno[1,2-d][1,3]thiazole is sourced from PubChem (CID 87388293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).