C72H94F6O9S3 — CID 87388535
bis(bis(4-octoxyphenyl)-phenylsulfanium);2,2,3,3,4,4-hexafluoro-4-sulfonatobutanoate (PubChem CID 87388535) has the molecular formula C72H94F6O9S3 and a molecular weight of 1313.72 g/mol. Its IUPAC name is bis(bis(4-octoxyphenyl)-phenylsulfanium);2,2,3,3,4,4-hexafluoro-4-sulfonatobutanoate.
| Compound Name | bis(bis(4-octoxyphenyl)-phenylsulfanium);2,2,3,3,4,4-hexafluoro-4-sulfonatobutanoate |
|---|---|
| PubChem CID | 87388535 |
| Molecular Formula | C72H94F6O9S3 |
| Molecular Weight | 1313.72 g/mol |
| Exact Mass | 1312.60 |
| IUPAC Name | bis(bis(4-octoxyphenyl)-phenylsulfanium);2,2,3,3,4,4-hexafluoro-4-sulfonatobutanoate |
| SMILES | CCCCCCCCOc1ccc([S+](c2ccccc2)c2ccc(OCCCCCCCC)cc2)cc1.CCCCCCCCOc1ccc([S+](c2ccccc2)c2ccc(OCCCCCCCC)cc2)cc1.O=C([O-])C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/2C34H47O2S.C4H2F6O5S/c2*1-3-5-7-9-11-16-28-35-30-20-24-33(25-21-30)37(32-18-14-13-15-19-32)34-26-22-31(23-27-34)36-29-17-12-10-8-6-4-2;5-2(6,1(11)12)3(7,8)4(9,10)16(13,14)15/h2*13-15,18-27H,3-12,16-17,28-29H2,1-2H3;(H,11,12)(H,13,14,15)/q2*+1;/p-2 |
| InChIKey | YNYRLWHQCNRYBI-UHFFFAOYSA-L |
| XLogP | 19.67 |
| TPSA | 134.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 90 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1313.72 |
| LogP ≤ 5 | 19.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|