C21H14ClF6N5O3 — CID 87388676
5-(4-chlorophenyl)-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-2-[[3-[2-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl]-1,2,4-triazol-3-one (PubChem CID 87388676) has the molecular formula C21H14ClF6N5O3 and a molecular weight of 533.82 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-2-[[3-[2-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl]-1,2,4-triazol-3-one.
| Compound Name | 5-(4-chlorophenyl)-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-2-[[3-[2-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 87388676 |
| Molecular Formula | C21H14ClF6N5O3 |
| Molecular Weight | 533.82 g/mol |
| Exact Mass | 533.07 |
| IUPAC Name | 5-(4-chlorophenyl)-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-2-[[3-[2-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl]-1,2,4-triazol-3-one |
| SMILES | O=c1n(Cc2nc(-c3ccccc3C(F)(F)F)no2)nc(-c2ccc(Cl)cc2)n1C[C@H](O)C(F)(F)F |
| InChI | InChI=1S/C21H14ClF6N5O3/c22-12-7-5-11(6-8-12)18-30-33(19(35)32(18)9-15(34)21(26,27)28)10-16-29-17(31-36-16)13-3-1-2-4-14(13)20(23,24)25/h1-8,15,34H,9-10H2/t15-/m0/s1 |
| InChIKey | LZLAQEJNKBBBQN-HNNXBMFYSA-N |
| XLogP | 4.41 |
| TPSA | 98.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.82 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |