C11H20N3Zr- — CID 87388746
1-N,1-N,2-N,2-N,3-N,3-N-hexamethylcyclopenta-1,3-diene-1,2,3-triamine;zirconium (PubChem CID 87388746) has the molecular formula C11H20N3Zr- and a molecular weight of 285.53 g/mol. Its IUPAC name is 1-N,1-N,2-N,2-N,3-N,3-N-hexamethylcyclopenta-1,3-diene-1,2,3-triamine;zirconium.
| Compound Name | 1-N,1-N,2-N,2-N,3-N,3-N-hexamethylcyclopenta-1,3-diene-1,2,3-triamine;zirconium |
|---|---|
| PubChem CID | 87388746 |
| Molecular Formula | C11H20N3Zr- |
| Molecular Weight | 285.53 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 1-N,1-N,2-N,2-N,3-N,3-N-hexamethylcyclopenta-1,3-diene-1,2,3-triamine;zirconium |
| SMILES | CN(C)C1=[C-]CC(N(C)C)=C1N(C)C.[Zr] |
| InChI | InChI=1S/C11H20N3.Zr/c1-12(2)9-7-8-10(13(3)4)11(9)14(5)6;/h7H2,1-6H3;/q-1; |
| InChIKey | UPEJPACHSCMOLE-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.53 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|