About 4-ethylidenehepta-1,6-diene;urea
4-ethylidenehepta-1,6-diene;urea (PubChem CID 87388861) has the molecular formula C10H18N2O
and a molecular weight of 182.27 g/mol. Its IUPAC name is 4-ethylidenehepta-1,6-diene;urea.
Molecular Properties
| Compound Name | 4-ethylidenehepta-1,6-diene;urea |
| PubChem CID | 87388861 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | 4-ethylidenehepta-1,6-diene;urea |
| SMILES | C=CCC(=CC)CC=C.NC(N)=O |
| InChI | InChI=1S/C9H14.CH4N2O/c1-4-7-9(6-3)8-5-2;2-1(3)4/h4-6H,1-2,7-8H2,3H3;(H4,2,3,4) |
| InChIKey | XFEIQYQUYRJCOW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-ethylidenehepta-1,6-diene;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylidenehepta-1,6-diene;urea?
The IUPAC name of 4-ethylidenehepta-1,6-diene;urea (CID 87388861) is 4-ethylidenehepta-1,6-diene;urea.
What is the SMILES notation for 4-ethylidenehepta-1,6-diene;urea?
The canonical SMILES for 4-ethylidenehepta-1,6-diene;urea is C=CCC(=CC)CC=C.NC(N)=O.
What is the InChIKey of 4-ethylidenehepta-1,6-diene;urea?
The InChIKey is XFEIQYQUYRJCOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14.CH4N2O/c1-4-7-9(6-3)8-5-2;2-1(3)4/h4-6H,1-2,7-8H2,3H3;(H4,2,3,4).
What are the key properties of 4-ethylidenehepta-1,6-diene;urea?
4-ethylidenehepta-1,6-diene;urea has a molecular weight of 182.27 g/mol, XLogP of 2.11, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylidenehepta-1,6-diene;urea is sourced from PubChem (CID 87388861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).