About oxidooxysulfonyl sulfate;bis(tetramethylphosphanium)
oxidooxysulfonyl sulfate;bis(tetramethylphosphanium) (PubChem CID 87388921) has the molecular formula C8H24O8P2S2
and a molecular weight of 374.35 g/mol. Its IUPAC name is oxidooxysulfonyl sulfate;bis(tetramethylphosphanium).
Molecular Properties
| Compound Name | oxidooxysulfonyl sulfate;bis(tetramethylphosphanium) |
| PubChem CID | 87388921 |
| Molecular Formula | C8H24O8P2S2 |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | oxidooxysulfonyl sulfate;bis(tetramethylphosphanium) |
| SMILES | C[P+](C)(C)C.C[P+](C)(C)C.O=S(=O)([O-])OS(=O)(=O)O[O-] |
| InChI | InChI=1S/2C4H12P.H2O8S2/c2*1-5(2,3)4;1-7-10(5,6)8-9(2,3)4/h2*1-4H3;1H,(H,2,3,4)/q2*+1;/p-2 |
| InChIKey | RKBAQGDVUPTKJH-UHFFFAOYSA-L |
| XLogP | 0.05 |
| TPSA | 132.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze oxidooxysulfonyl sulfate;bis(tetramethylphosphanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxidooxysulfonyl sulfate;bis(tetramethylphosphanium)?
The IUPAC name of oxidooxysulfonyl sulfate;bis(tetramethylphosphanium) (CID 87388921) is oxidooxysulfonyl sulfate;bis(tetramethylphosphanium).
What is the SMILES notation for oxidooxysulfonyl sulfate;bis(tetramethylphosphanium)?
The canonical SMILES for oxidooxysulfonyl sulfate;bis(tetramethylphosphanium) is C[P+](C)(C)C.C[P+](C)(C)C.O=S(=O)([O-])OS(=O)(=O)O[O-].
What is the InChIKey of oxidooxysulfonyl sulfate;bis(tetramethylphosphanium)?
The InChIKey is RKBAQGDVUPTKJH-UHFFFAOYSA-L. The full InChI is InChI=1S/2C4H12P.H2O8S2/c2*1-5(2,3)4;1-7-10(5,6)8-9(2,3)4/h2*1-4H3;1H,(H,2,3,4)/q2*+1;/p-2.
What are the key properties of oxidooxysulfonyl sulfate;bis(tetramethylphosphanium)?
oxidooxysulfonyl sulfate;bis(tetramethylphosphanium) has a molecular weight of 374.35 g/mol, XLogP of 0.05, 3 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for oxidooxysulfonyl sulfate;bis(tetramethylphosphanium) is sourced from PubChem (CID 87388921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).