C25H23FN6O2 — CID 87389356
2-[4-(4-fluoro-N-methylanilino)-2-[4-(1,3-oxazol-5-yl)anilino]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]acetaldehyde (PubChem CID 87389356) has the molecular formula C25H23FN6O2 and a molecular weight of 458.50 g/mol. Its IUPAC name is 2-[4-(4-fluoro-N-methylanilino)-2-[4-(1,3-oxazol-5-yl)anilino]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]acetaldehyde.
| Compound Name | 2-[4-(4-fluoro-N-methylanilino)-2-[4-(1,3-oxazol-5-yl)anilino]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]acetaldehyde |
|---|---|
| PubChem CID | 87389356 |
| Molecular Formula | C25H23FN6O2 |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | 2-[4-(4-fluoro-N-methylanilino)-2-[4-(1,3-oxazol-5-yl)anilino]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]acetaldehyde |
| SMILES | CN(c1ccc(F)cc1)c1nc(Nc2ccc(-c3cnco3)cc2)nc2c1CN(CC=O)CC2 |
| InChI | InChI=1S/C25H23FN6O2/c1-31(20-8-4-18(26)5-9-20)24-21-15-32(12-13-33)11-10-22(21)29-25(30-24)28-19-6-2-17(3-7-19)23-14-27-16-34-23/h2-9,13-14,16H,10-12,15H2,1H3,(H,28,29,30) |
| InChIKey | BJNYMJOMNDWPNC-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|