C17H20N6O — CID 87389384
N-[(Z)-[imidazol-1-yl-[1-(2-phenoxyethyl)imidazol-2-yl]methylidene]amino]-N-methylmethanamine (PubChem CID 87389384) has the molecular formula C17H20N6O and a molecular weight of 324.39 g/mol. Its IUPAC name is N-[(Z)-[imidazol-1-yl-[1-(2-phenoxyethyl)imidazol-2-yl]methylidene]amino]-N-methylmethanamine.
| Compound Name | N-[(Z)-[imidazol-1-yl-[1-(2-phenoxyethyl)imidazol-2-yl]methylidene]amino]-N-methylmethanamine |
|---|---|
| PubChem CID | 87389384 |
| Molecular Formula | C17H20N6O |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | N-[(Z)-[imidazol-1-yl-[1-(2-phenoxyethyl)imidazol-2-yl]methylidene]amino]-N-methylmethanamine |
| SMILES | CN(C)/N=C(/c1nccn1CCOc1ccccc1)n1ccnc1 |
| InChI | InChI=1S/C17H20N6O/c1-21(2)20-17(23-10-8-18-14-23)16-19-9-11-22(16)12-13-24-15-6-4-3-5-7-15/h3-11,14H,12-13H2,1-2H3/b20-17- |
| InChIKey | RIRJVYNBFMEVHR-JZJYNLBNSA-N |
| XLogP | 1.93 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|