About 2-(diethylamino)ethyl hypochlorite
2-(diethylamino)ethyl hypochlorite (PubChem CID 87389474) has the molecular formula C6H14ClNO
and a molecular weight of 151.64 g/mol. Its IUPAC name is 2-(diethylamino)ethyl hypochlorite.
Molecular Properties
| Compound Name | 2-(diethylamino)ethyl hypochlorite |
| PubChem CID | 87389474 |
| Molecular Formula | C6H14ClNO |
| Molecular Weight | 151.64 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | 2-(diethylamino)ethyl hypochlorite |
| SMILES | CCN(CC)CCOCl |
| InChI | InChI=1S/C6H14ClNO/c1-3-8(4-2)5-6-9-7/h3-6H2,1-2H3 |
| InChIKey | KLMFEQSZJKSUOZ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.64 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(diethylamino)ethyl hypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethyl hypochlorite?
The IUPAC name of 2-(diethylamino)ethyl hypochlorite (CID 87389474) is 2-(diethylamino)ethyl hypochlorite.
What is the SMILES notation for 2-(diethylamino)ethyl hypochlorite?
The canonical SMILES for 2-(diethylamino)ethyl hypochlorite is CCN(CC)CCOCl.
What is the InChIKey of 2-(diethylamino)ethyl hypochlorite?
The InChIKey is KLMFEQSZJKSUOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14ClNO/c1-3-8(4-2)5-6-9-7/h3-6H2,1-2H3.
What are the key properties of 2-(diethylamino)ethyl hypochlorite?
2-(diethylamino)ethyl hypochlorite has a molecular weight of 151.64 g/mol, XLogP of 1.50, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethyl hypochlorite is sourced from PubChem (CID 87389474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).