C12H24N2O3 — CID 87389517
butyl N-[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]-N-methylcarbamate (PubChem CID 87389517) has the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. Its IUPAC name is butyl N-[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]-N-methylcarbamate.
| Compound Name | butyl N-[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 87389517 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | butyl N-[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]-N-methylcarbamate |
| SMILES | CCCCOC(=O)N(C)[C@@H](CC(C)C)C(N)=O |
| InChI | InChI=1S/C12H24N2O3/c1-5-6-7-17-12(16)14(4)10(11(13)15)8-9(2)3/h9-10H,5-8H2,1-4H3,(H2,13,15)/t10-/m0/s1 |
| InChIKey | ORDNHJNXEUTXJP-JTQLQIEISA-N |
| XLogP | 1.75 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|