About [1-[5-(3,3,3-trifluoropropyl)pyrimidin-2-yl]piperidin-2-yl] methanesulfonate
[1-[5-(3,3,3-trifluoropropyl)pyrimidin-2-yl]piperidin-2-yl] methanesulfonate (PubChem CID 87389742) has the molecular formula C13H18F3N3O3S
and a molecular weight of 353.37 g/mol. Its IUPAC name is [1-[5-(3,3,3-trifluoropropyl)pyrimidin-2-yl]piperidin-2-yl] methanesulfonate.
Molecular Properties
| Compound Name | [1-[5-(3,3,3-trifluoropropyl)pyrimidin-2-yl]piperidin-2-yl] methanesulfonate |
| PubChem CID | 87389742 |
| Molecular Formula | C13H18F3N3O3S |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | [1-[5-(3,3,3-trifluoropropyl)pyrimidin-2-yl]piperidin-2-yl] methanesulfonate |
| SMILES | CS(=O)(=O)OC1CCCCN1c1ncc(CCC(F)(F)F)cn1 |
| InChI | InChI=1S/C13H18F3N3O3S/c1-23(20,21)22-11-4-2-3-7-19(11)12-17-8-10(9-18-12)5-6-13(14,15)16/h8-9,11H,2-7H2,1H3 |
| InChIKey | DCSFLZTUVTZGMR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [1-[5-(3,3,3-trifluoropropyl)pyrimidin-2-yl]piperidin-2-yl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[5-(3,3,3-trifluoropropyl)pyrimidin-2-yl]piperidin-2-yl] methanesulfonate?
The IUPAC name of [1-[5-(3,3,3-trifluoropropyl)pyrimidin-2-yl]piperidin-2-yl] methanesulfonate (CID 87389742) is [1-[5-(3,3,3-trifluoropropyl)pyrimidin-2-yl]piperidin-2-yl] methanesulfonate.
What is the SMILES notation for [1-[5-(3,3,3-trifluoropropyl)pyrimidin-2-yl]piperidin-2-yl] methanesulfonate?
The canonical SMILES for [1-[5-(3,3,3-trifluoropropyl)pyrimidin-2-yl]piperidin-2-yl] methanesulfonate is CS(=O)(=O)OC1CCCCN1c1ncc(CCC(F)(F)F)cn1.
What is the InChIKey of [1-[5-(3,3,3-trifluoropropyl)pyrimidin-2-yl]piperidin-2-yl] methanesulfonate?
The InChIKey is DCSFLZTUVTZGMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18F3N3O3S/c1-23(20,21)22-11-4-2-3-7-19(11)12-17-8-10(9-18-12)5-6-13(14,15)16/h8-9,11H,2-7H2,1H3.
What are the key properties of [1-[5-(3,3,3-trifluoropropyl)pyrimidin-2-yl]piperidin-2-yl] methanesulfonate?
[1-[5-(3,3,3-trifluoropropyl)pyrimidin-2-yl]piperidin-2-yl] methanesulfonate has a molecular weight of 353.37 g/mol, XLogP of 2.26, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[5-(3,3,3-trifluoropropyl)pyrimidin-2-yl]piperidin-2-yl] methanesulfonate is sourced from PubChem (CID 87389742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).