About tetracene-1,6-dione
tetracene-1,6-dione (PubChem CID 87390098) has the molecular formula C18H10O2
and a molecular weight of 258.28 g/mol. Its IUPAC name is tetracene-1,6-dione.
Molecular Properties
| Compound Name | tetracene-1,6-dione |
| PubChem CID | 87390098 |
| Molecular Formula | C18H10O2 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | tetracene-1,6-dione |
| SMILES | O=C1C=CC=c2cc3c(cc21)=Cc1ccccc1C3=O |
| InChI | InChI=1S/C18H10O2/c19-17-7-3-5-12-9-16-13(10-15(12)17)8-11-4-1-2-6-14(11)18(16)20/h1-10H |
| InChIKey | AXCDMADKFWOSPO-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze tetracene-1,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetracene-1,6-dione?
The IUPAC name of tetracene-1,6-dione (CID 87390098) is tetracene-1,6-dione.
What is the SMILES notation for tetracene-1,6-dione?
The canonical SMILES for tetracene-1,6-dione is O=C1C=CC=c2cc3c(cc21)=Cc1ccccc1C3=O.
What is the InChIKey of tetracene-1,6-dione?
The InChIKey is AXCDMADKFWOSPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H10O2/c19-17-7-3-5-12-9-16-13(10-15(12)17)8-11-4-1-2-6-14(11)18(16)20/h1-10H.
What are the key properties of tetracene-1,6-dione?
tetracene-1,6-dione has a molecular weight of 258.28 g/mol, XLogP of 1.59, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tetracene-1,6-dione is sourced from PubChem (CID 87390098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).