C20H29N3O4S — CID 87390404
2-tert-butyl-2-[[[(1R)-2-methoxy-2-oxo-1-phenylethyl]carbamothioylamino]methyl]pyrrolidine-1-carboxylic acid (PubChem CID 87390404) has the molecular formula C20H29N3O4S and a molecular weight of 407.54 g/mol. Its IUPAC name is 2-tert-butyl-2-[[[(1R)-2-methoxy-2-oxo-1-phenylethyl]carbamothioylamino]methyl]pyrrolidine-1-carboxylic acid.
| Compound Name | 2-tert-butyl-2-[[[(1R)-2-methoxy-2-oxo-1-phenylethyl]carbamothioylamino]methyl]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 87390404 |
| Molecular Formula | C20H29N3O4S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | 2-tert-butyl-2-[[[(1R)-2-methoxy-2-oxo-1-phenylethyl]carbamothioylamino]methyl]pyrrolidine-1-carboxylic acid |
| SMILES | COC(=O)[C@H](NC(=S)NCC1(C(C)(C)C)CCCN1C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C20H29N3O4S/c1-19(2,3)20(11-8-12-23(20)18(25)26)13-21-17(28)22-15(16(24)27-4)14-9-6-5-7-10-14/h5-7,9-10,15H,8,11-13H2,1-4H3,(H,25,26)(H2,21,22,28)/t15-,20?/m1/s1 |
| InChIKey | HZOAMJWMWGHEOV-IWPPFLRJSA-N |
| XLogP | 2.92 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|