About diethyl oxiran-2-yl propyl silicate
diethyl oxiran-2-yl propyl silicate (PubChem CID 87390747) has the molecular formula C9H20O5Si
and a molecular weight of 236.34 g/mol. Its IUPAC name is diethyl oxiran-2-yl propyl silicate.
Molecular Properties
| Compound Name | diethyl oxiran-2-yl propyl silicate |
| PubChem CID | 87390747 |
| Molecular Formula | C9H20O5Si |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | diethyl oxiran-2-yl propyl silicate |
| SMILES | CCCO[Si](OCC)(OCC)OC1CO1 |
| InChI | InChI=1S/C9H20O5Si/c1-4-7-13-15(11-5-2,12-6-3)14-9-8-10-9/h9H,4-8H2,1-3H3 |
| InChIKey | HSNHVPWQPUMGKS-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze diethyl oxiran-2-yl propyl silicate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl oxiran-2-yl propyl silicate?
The IUPAC name of diethyl oxiran-2-yl propyl silicate (CID 87390747) is diethyl oxiran-2-yl propyl silicate.
What is the SMILES notation for diethyl oxiran-2-yl propyl silicate?
The canonical SMILES for diethyl oxiran-2-yl propyl silicate is CCCO[Si](OCC)(OCC)OC1CO1.
What is the InChIKey of diethyl oxiran-2-yl propyl silicate?
The InChIKey is HSNHVPWQPUMGKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20O5Si/c1-4-7-13-15(11-5-2,12-6-3)14-9-8-10-9/h9H,4-8H2,1-3H3.
What are the key properties of diethyl oxiran-2-yl propyl silicate?
diethyl oxiran-2-yl propyl silicate has a molecular weight of 236.34 g/mol, XLogP of 1.29, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl oxiran-2-yl propyl silicate is sourced from PubChem (CID 87390747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).