About N,N-difluoro-4,5-dinitro-1H-pyrazol-3-amine
N,N-difluoro-4,5-dinitro-1H-pyrazol-3-amine (PubChem CID 87391679) has the molecular formula C3HF2N5O4
and a molecular weight of 209.07 g/mol. Its IUPAC name is N,N-difluoro-4,5-dinitro-1H-pyrazol-3-amine.
Molecular Properties
| Compound Name | N,N-difluoro-4,5-dinitro-1H-pyrazol-3-amine |
| PubChem CID | 87391679 |
| Molecular Formula | C3HF2N5O4 |
| Molecular Weight | 209.07 g/mol |
| Exact Mass | 209.00 |
| IUPAC Name | N,N-difluoro-4,5-dinitro-1H-pyrazol-3-amine |
| SMILES | O=[N+]([O-])c1[nH]nc(N(F)F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C3HF2N5O4/c4-8(5)2-1(9(11)12)3(7-6-2)10(13)14/h(H,6,7) |
| InChIKey | BEGIHXRNDMXESM-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 118.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.07 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N-difluoro-4,5-dinitro-1H-pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-difluoro-4,5-dinitro-1H-pyrazol-3-amine?
The IUPAC name of N,N-difluoro-4,5-dinitro-1H-pyrazol-3-amine (CID 87391679) is N,N-difluoro-4,5-dinitro-1H-pyrazol-3-amine.
What is the SMILES notation for N,N-difluoro-4,5-dinitro-1H-pyrazol-3-amine?
The canonical SMILES for N,N-difluoro-4,5-dinitro-1H-pyrazol-3-amine is O=[N+]([O-])c1[nH]nc(N(F)F)c1[N+](=O)[O-].
What is the InChIKey of N,N-difluoro-4,5-dinitro-1H-pyrazol-3-amine?
The InChIKey is BEGIHXRNDMXESM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3HF2N5O4/c4-8(5)2-1(9(11)12)3(7-6-2)10(13)14/h(H,6,7).
What are the key properties of N,N-difluoro-4,5-dinitro-1H-pyrazol-3-amine?
N,N-difluoro-4,5-dinitro-1H-pyrazol-3-amine has a molecular weight of 209.07 g/mol, XLogP of 0.80, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-difluoro-4,5-dinitro-1H-pyrazol-3-amine is sourced from PubChem (CID 87391679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).