About bis(4-chloro-3,5-difluorophenyl)iodanium
bis(4-chloro-3,5-difluorophenyl)iodanium (PubChem CID 87391878) has the molecular formula C12H4Cl2F4I+
and a molecular weight of 421.97 g/mol. Its IUPAC name is bis(4-chloro-3,5-difluorophenyl)iodanium.
Molecular Properties
| Compound Name | bis(4-chloro-3,5-difluorophenyl)iodanium |
| PubChem CID | 87391878 |
| Molecular Formula | C12H4Cl2F4I+ |
| Molecular Weight | 421.97 g/mol |
| Exact Mass | 420.87 |
| IUPAC Name | bis(4-chloro-3,5-difluorophenyl)iodanium |
| SMILES | Fc1cc([I+]c2cc(F)c(Cl)c(F)c2)cc(F)c1Cl |
| InChI | InChI=1S/C12H4Cl2F4I/c13-11-7(15)1-5(2-8(11)16)19-6-3-9(17)12(14)10(18)4-6/h1-4H/q+1 |
| InChIKey | ZSBSUUJQKBBLLA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.97 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze bis(4-chloro-3,5-difluorophenyl)iodanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-chloro-3,5-difluorophenyl)iodanium?
The IUPAC name of bis(4-chloro-3,5-difluorophenyl)iodanium (CID 87391878) is bis(4-chloro-3,5-difluorophenyl)iodanium.
What is the SMILES notation for bis(4-chloro-3,5-difluorophenyl)iodanium?
The canonical SMILES for bis(4-chloro-3,5-difluorophenyl)iodanium is Fc1cc([I+]c2cc(F)c(Cl)c(F)c2)cc(F)c1Cl.
What is the InChIKey of bis(4-chloro-3,5-difluorophenyl)iodanium?
The InChIKey is ZSBSUUJQKBBLLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H4Cl2F4I/c13-11-7(15)1-5(2-8(11)16)19-6-3-9(17)12(14)10(18)4-6/h1-4H/q+1.
What are the key properties of bis(4-chloro-3,5-difluorophenyl)iodanium?
bis(4-chloro-3,5-difluorophenyl)iodanium has a molecular weight of 421.97 g/mol, XLogP of 1.68, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-chloro-3,5-difluorophenyl)iodanium is sourced from PubChem (CID 87391878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).