About sodium;2-hydroxyethanesulfonate;2H-oxete
sodium;2-hydroxyethanesulfonate;2H-oxete (PubChem CID 87391901) has the molecular formula C5H9NaO5S
and a molecular weight of 204.18 g/mol. Its IUPAC name is sodium;2-hydroxyethanesulfonate;2H-oxete.
Molecular Properties
| Compound Name | sodium;2-hydroxyethanesulfonate;2H-oxete |
| PubChem CID | 87391901 |
| Molecular Formula | C5H9NaO5S |
| Molecular Weight | 204.18 g/mol |
| Exact Mass | 204.01 |
| IUPAC Name | sodium;2-hydroxyethanesulfonate;2H-oxete |
| SMILES | C1=COC1.O=S(=O)([O-])CCO.[Na+] |
| InChI | InChI=1S/C3H4O.C2H6O4S.Na/c1-2-4-3-1;3-1-2-7(4,5)6;/h1-2H,3H2;3H,1-2H2,(H,4,5,6);/q;;+1/p-1 |
| InChIKey | JVJIHRPDGZKZEC-UHFFFAOYSA-M |
| XLogP | -3.94 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.18 |
| LogP ≤ 5 | -3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;2-hydroxyethanesulfonate;2H-oxete with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-hydroxyethanesulfonate;2H-oxete?
The IUPAC name of sodium;2-hydroxyethanesulfonate;2H-oxete (CID 87391901) is sodium;2-hydroxyethanesulfonate;2H-oxete.
What is the SMILES notation for sodium;2-hydroxyethanesulfonate;2H-oxete?
The canonical SMILES for sodium;2-hydroxyethanesulfonate;2H-oxete is C1=COC1.O=S(=O)([O-])CCO.[Na+].
What is the InChIKey of sodium;2-hydroxyethanesulfonate;2H-oxete?
The InChIKey is JVJIHRPDGZKZEC-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H4O.C2H6O4S.Na/c1-2-4-3-1;3-1-2-7(4,5)6;/h1-2H,3H2;3H,1-2H2,(H,4,5,6);/q;;+1/p-1.
What are the key properties of sodium;2-hydroxyethanesulfonate;2H-oxete?
sodium;2-hydroxyethanesulfonate;2H-oxete has a molecular weight of 204.18 g/mol, XLogP of -3.94, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-hydroxyethanesulfonate;2H-oxete is sourced from PubChem (CID 87391901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).