About but-1-ene;2-(oxiran-2-ylmethoxymethyl)oxirane
but-1-ene;2-(oxiran-2-ylmethoxymethyl)oxirane (PubChem CID 87391943) has the molecular formula C10H18O3
and a molecular weight of 186.25 g/mol. Its IUPAC name is but-1-ene;2-(oxiran-2-ylmethoxymethyl)oxirane.
Molecular Properties
| Compound Name | but-1-ene;2-(oxiran-2-ylmethoxymethyl)oxirane |
| PubChem CID | 87391943 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | but-1-ene;2-(oxiran-2-ylmethoxymethyl)oxirane |
| SMILES | C(OCC1CO1)C1CO1.C=CCC |
| InChI | InChI=1S/C6H10O3.C4H8/c1(5-3-8-5)7-2-6-4-9-6;1-3-4-2/h5-6H,1-4H2;3H,1,4H2,2H3 |
| InChIKey | OXXDYIODPJSOMH-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 34.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze but-1-ene;2-(oxiran-2-ylmethoxymethyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-1-ene;2-(oxiran-2-ylmethoxymethyl)oxirane?
The IUPAC name of but-1-ene;2-(oxiran-2-ylmethoxymethyl)oxirane (CID 87391943) is but-1-ene;2-(oxiran-2-ylmethoxymethyl)oxirane.
What is the SMILES notation for but-1-ene;2-(oxiran-2-ylmethoxymethyl)oxirane?
The canonical SMILES for but-1-ene;2-(oxiran-2-ylmethoxymethyl)oxirane is C(OCC1CO1)C1CO1.C=CCC.
What is the InChIKey of but-1-ene;2-(oxiran-2-ylmethoxymethyl)oxirane?
The InChIKey is OXXDYIODPJSOMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3.C4H8/c1(5-3-8-5)7-2-6-4-9-6;1-3-4-2/h5-6H,1-4H2;3H,1,4H2,2H3.
What are the key properties of but-1-ene;2-(oxiran-2-ylmethoxymethyl)oxirane?
but-1-ene;2-(oxiran-2-ylmethoxymethyl)oxirane has a molecular weight of 186.25 g/mol, XLogP of 1.38, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for but-1-ene;2-(oxiran-2-ylmethoxymethyl)oxirane is sourced from PubChem (CID 87391943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).