C10H11F10N3O4S2 — CID 87392427
bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanide;2-ethyl-3-methyl-1H-imidazol-3-ium (PubChem CID 87392427) has the molecular formula C10H11F10N3O4S2 and a molecular weight of 491.33 g/mol. Its IUPAC name is bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanide;2-ethyl-3-methyl-1H-imidazol-3-ium.
| Compound Name | bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanide;2-ethyl-3-methyl-1H-imidazol-3-ium |
|---|---|
| PubChem CID | 87392427 |
| Molecular Formula | C10H11F10N3O4S2 |
| Molecular Weight | 491.33 g/mol |
| Exact Mass | 491.00 |
| IUPAC Name | bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanide;2-ethyl-3-methyl-1H-imidazol-3-ium |
| SMILES | CCc1[nH]cc[n+]1C.O=S(=O)([N-]S(=O)(=O)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H10N2.C4F10NO4S2/c1-3-6-7-4-5-8(6)2;5-1(6,7)3(11,12)20(16,17)15-21(18,19)4(13,14)2(8,9)10/h4-5H,3H2,1-2H3;/q;-1/p+1 |
| InChIKey | KDOQGRPFNZNXIA-UHFFFAOYSA-O |
| XLogP | 2.73 |
| TPSA | 102.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|