About 1-methoxy-2,2-dimethyltridecan-6-one
1-methoxy-2,2-dimethyltridecan-6-one (PubChem CID 87392434) has the molecular formula C16H32O2
and a molecular weight of 256.43 g/mol. Its IUPAC name is 1-methoxy-2,2-dimethyltridecan-6-one.
Molecular Properties
| Compound Name | 1-methoxy-2,2-dimethyltridecan-6-one |
| PubChem CID | 87392434 |
| Molecular Formula | C16H32O2 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.24 |
| IUPAC Name | 1-methoxy-2,2-dimethyltridecan-6-one |
| SMILES | CCCCCCCC(=O)CCCC(C)(C)COC |
| InChI | InChI=1S/C16H32O2/c1-5-6-7-8-9-11-15(17)12-10-13-16(2,3)14-18-4/h5-14H2,1-4H3 |
| InChIKey | BLNXKISHKKGESL-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxy-2,2-dimethyltridecan-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-2,2-dimethyltridecan-6-one?
The IUPAC name of 1-methoxy-2,2-dimethyltridecan-6-one (CID 87392434) is 1-methoxy-2,2-dimethyltridecan-6-one.
What is the SMILES notation for 1-methoxy-2,2-dimethyltridecan-6-one?
The canonical SMILES for 1-methoxy-2,2-dimethyltridecan-6-one is CCCCCCCC(=O)CCCC(C)(C)COC.
What is the InChIKey of 1-methoxy-2,2-dimethyltridecan-6-one?
The InChIKey is BLNXKISHKKGESL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O2/c1-5-6-7-8-9-11-15(17)12-10-13-16(2,3)14-18-4/h5-14H2,1-4H3.
What are the key properties of 1-methoxy-2,2-dimethyltridecan-6-one?
1-methoxy-2,2-dimethyltridecan-6-one has a molecular weight of 256.43 g/mol, XLogP of 4.76, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-2,2-dimethyltridecan-6-one is sourced from PubChem (CID 87392434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).