C22H21F7N2O4S — CID 87392755
3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-2-N-(1-methylsulfonylpropan-2-yl)benzene-1,2-dicarboxamide (PubChem CID 87392755) has the molecular formula C22H21F7N2O4S and a molecular weight of 542.47 g/mol. Its IUPAC name is 3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-2-N-(1-methylsulfonylpropan-2-yl)benzene-1,2-dicarboxamide.
| Compound Name | 3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-2-N-(1-methylsulfonylpropan-2-yl)benzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 87392755 |
| Molecular Formula | C22H21F7N2O4S |
| Molecular Weight | 542.47 g/mol |
| Exact Mass | 542.11 |
| IUPAC Name | 3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-2-N-(1-methylsulfonylpropan-2-yl)benzene-1,2-dicarboxamide |
| SMILES | Cc1cc(C(F)(C(F)(F)F)C(F)(F)F)ccc1-c1cccc(C(N)=O)c1C(=O)NC(C)CS(C)(=O)=O |
| InChI | InChI=1S/C22H21F7N2O4S/c1-11-9-13(20(23,21(24,25)26)22(27,28)29)7-8-14(11)15-5-4-6-16(18(30)32)17(15)19(33)31-12(2)10-36(3,34)35/h4-9,12H,10H2,1-3H3,(H2,30,32)(H,31,33) |
| InChIKey | LHVKEQUYTFDJRA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.47 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |