About benzamide;4-[2-[(4-chlorophenyl)methyl]tetrazol-5-yl]-4-phenylpiperidine-1-carbothioic S-acid
benzamide;4-[2-[(4-chlorophenyl)methyl]tetrazol-5-yl]-4-phenylpiperidine-1-carbothioic S-acid (PubChem CID 87392865) has the molecular formula C27H27ClN6O2S
and a molecular weight of 535.07 g/mol. Its IUPAC name is benzamide;4-[2-[(4-chlorophenyl)methyl]tetrazol-5-yl]-4-phenylpiperidine-1-carbothioic S-acid.
Molecular Properties
| Compound Name | benzamide;4-[2-[(4-chlorophenyl)methyl]tetrazol-5-yl]-4-phenylpiperidine-1-carbothioic S-acid |
| PubChem CID | 87392865 |
| Molecular Formula | C27H27ClN6O2S |
| Molecular Weight | 535.07 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | benzamide;4-[2-[(4-chlorophenyl)methyl]tetrazol-5-yl]-4-phenylpiperidine-1-carbothioic S-acid |
| SMILES | NC(=O)c1ccccc1.O=C(S)N1CCC(c2ccccc2)(c2nnn(Cc3ccc(Cl)cc3)n2)CC1 |
| InChI | InChI=1S/C20H20ClN5OS.C7H7NO/c21-17-8-6-15(7-9-17)14-26-23-18(22-24-26)20(16-4-2-1-3-5-16)10-12-25(13-11-20)19(27)28;8-7(9)6-4-2-1-3-5-6/h1-9H,10-14H2,(H,27,28);1-5H,(H2,8,9) |
| InChIKey | IAIODCDLYAIZSC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 107.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 535.07 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze benzamide;4-[2-[(4-chlorophenyl)methyl]tetrazol-5-yl]-4-phenylpiperidine-1-carbothioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzamide;4-[2-[(4-chlorophenyl)methyl]tetrazol-5-yl]-4-phenylpiperidine-1-carbothioic S-acid?
The IUPAC name of benzamide;4-[2-[(4-chlorophenyl)methyl]tetrazol-5-yl]-4-phenylpiperidine-1-carbothioic S-acid (CID 87392865) is benzamide;4-[2-[(4-chlorophenyl)methyl]tetrazol-5-yl]-4-phenylpiperidine-1-carbothioic S-acid.
What is the SMILES notation for benzamide;4-[2-[(4-chlorophenyl)methyl]tetrazol-5-yl]-4-phenylpiperidine-1-carbothioic S-acid?
The canonical SMILES for benzamide;4-[2-[(4-chlorophenyl)methyl]tetrazol-5-yl]-4-phenylpiperidine-1-carbothioic S-acid is NC(=O)c1ccccc1.O=C(S)N1CCC(c2ccccc2)(c2nnn(Cc3ccc(Cl)cc3)n2)CC1.
What is the InChIKey of benzamide;4-[2-[(4-chlorophenyl)methyl]tetrazol-5-yl]-4-phenylpiperidine-1-carbothioic S-acid?
The InChIKey is IAIODCDLYAIZSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20ClN5OS.C7H7NO/c21-17-8-6-15(7-9-17)14-26-23-18(22-24-26)20(16-4-2-1-3-5-16)10-12-25(13-11-20)19(27)28;8-7(9)6-4-2-1-3-5-6/h1-9H,10-14H2,(H,27,28);1-5H,(H2,8,9).
What are the key properties of benzamide;4-[2-[(4-chlorophenyl)methyl]tetrazol-5-yl]-4-phenylpiperidine-1-carbothioic S-acid?
benzamide;4-[2-[(4-chlorophenyl)methyl]tetrazol-5-yl]-4-phenylpiperidine-1-carbothioic S-acid has a molecular weight of 535.07 g/mol, XLogP of 4.59, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzamide;4-[2-[(4-chlorophenyl)methyl]tetrazol-5-yl]-4-phenylpiperidine-1-carbothioic S-acid is sourced from PubChem (CID 87392865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).