About 3-(4-fluorophenyl)-2,4,4-trimethoxybut-1-en-1-one
3-(4-fluorophenyl)-2,4,4-trimethoxybut-1-en-1-one (PubChem CID 87392983) has the molecular formula C13H15FO4
and a molecular weight of 254.26 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-2,4,4-trimethoxybut-1-en-1-one.
Molecular Properties
| Compound Name | 3-(4-fluorophenyl)-2,4,4-trimethoxybut-1-en-1-one |
| PubChem CID | 87392983 |
| Molecular Formula | C13H15FO4 |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 3-(4-fluorophenyl)-2,4,4-trimethoxybut-1-en-1-one |
| SMILES | COC(=C=O)C(c1ccc(F)cc1)C(OC)OC |
| InChI | InChI=1S/C13H15FO4/c1-16-11(8-15)12(13(17-2)18-3)9-4-6-10(14)7-5-9/h4-7,12-13H,1-3H3 |
| InChIKey | IJEFPJWMYYYFCG-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-fluorophenyl)-2,4,4-trimethoxybut-1-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-fluorophenyl)-2,4,4-trimethoxybut-1-en-1-one?
The IUPAC name of 3-(4-fluorophenyl)-2,4,4-trimethoxybut-1-en-1-one (CID 87392983) is 3-(4-fluorophenyl)-2,4,4-trimethoxybut-1-en-1-one.
What is the SMILES notation for 3-(4-fluorophenyl)-2,4,4-trimethoxybut-1-en-1-one?
The canonical SMILES for 3-(4-fluorophenyl)-2,4,4-trimethoxybut-1-en-1-one is COC(=C=O)C(c1ccc(F)cc1)C(OC)OC.
What is the InChIKey of 3-(4-fluorophenyl)-2,4,4-trimethoxybut-1-en-1-one?
The InChIKey is IJEFPJWMYYYFCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15FO4/c1-16-11(8-15)12(13(17-2)18-3)9-4-6-10(14)7-5-9/h4-7,12-13H,1-3H3.
What are the key properties of 3-(4-fluorophenyl)-2,4,4-trimethoxybut-1-en-1-one?
3-(4-fluorophenyl)-2,4,4-trimethoxybut-1-en-1-one has a molecular weight of 254.26 g/mol, XLogP of 1.89, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-fluorophenyl)-2,4,4-trimethoxybut-1-en-1-one is sourced from PubChem (CID 87392983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).