About 2-[(3R,5R)-3-amino-5-methylpiperidin-1-yl]acetaldehyde
2-[(3R,5R)-3-amino-5-methylpiperidin-1-yl]acetaldehyde (PubChem CID 87393131) has the molecular formula C8H16N2O
and a molecular weight of 156.23 g/mol. Its IUPAC name is 2-[(3R,5R)-3-amino-5-methylpiperidin-1-yl]acetaldehyde.
Molecular Properties
| Compound Name | 2-[(3R,5R)-3-amino-5-methylpiperidin-1-yl]acetaldehyde |
| PubChem CID | 87393131 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 2-[(3R,5R)-3-amino-5-methylpiperidin-1-yl]acetaldehyde |
| SMILES | C[C@@H]1C[C@@H](N)CN(CC=O)C1 |
| InChI | InChI=1S/C8H16N2O/c1-7-4-8(9)6-10(5-7)2-3-11/h3,7-8H,2,4-6,9H2,1H3/t7-,8-/m1/s1 |
| InChIKey | YTOIDNPMDZDPNC-HTQZYQBOSA-N |
| XLogP | -0.15 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3R,5R)-3-amino-5-methylpiperidin-1-yl]acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3R,5R)-3-amino-5-methylpiperidin-1-yl]acetaldehyde?
The IUPAC name of 2-[(3R,5R)-3-amino-5-methylpiperidin-1-yl]acetaldehyde (CID 87393131) is 2-[(3R,5R)-3-amino-5-methylpiperidin-1-yl]acetaldehyde.
What is the SMILES notation for 2-[(3R,5R)-3-amino-5-methylpiperidin-1-yl]acetaldehyde?
The canonical SMILES for 2-[(3R,5R)-3-amino-5-methylpiperidin-1-yl]acetaldehyde is C[C@@H]1C[C@@H](N)CN(CC=O)C1.
What is the InChIKey of 2-[(3R,5R)-3-amino-5-methylpiperidin-1-yl]acetaldehyde?
The InChIKey is YTOIDNPMDZDPNC-HTQZYQBOSA-N. The full InChI is InChI=1S/C8H16N2O/c1-7-4-8(9)6-10(5-7)2-3-11/h3,7-8H,2,4-6,9H2,1H3/t7-,8-/m1/s1.
What are the key properties of 2-[(3R,5R)-3-amino-5-methylpiperidin-1-yl]acetaldehyde?
2-[(3R,5R)-3-amino-5-methylpiperidin-1-yl]acetaldehyde has a molecular weight of 156.23 g/mol, XLogP of -0.15, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3R,5R)-3-amino-5-methylpiperidin-1-yl]acetaldehyde is sourced from PubChem (CID 87393131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).