C8H16N2O — CID 87393131
2-[(3R,5R)-3-amino-5-methylpiperidin-1-yl]acetaldehyde (PubChem CID 87393131) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is 2-[(3R,5R)-3-amino-5-methylpiperidin-1-yl]acetaldehyde.
| Compound Name | 2-[(3R,5R)-3-amino-5-methylpiperidin-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 87393131 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 2-[(3R,5R)-3-amino-5-methylpiperidin-1-yl]acetaldehyde |
| SMILES | C[C@@H]1C[C@@H](N)CN(CC=O)C1 |
| InChI | InChI=1S/C8H16N2O/c1-7-4-8(9)6-10(5-7)2-3-11/h3,7-8H,2,4-6,9H2,1H3/t7-,8-/m1/s1 |
| InChIKey | YTOIDNPMDZDPNC-HTQZYQBOSA-N |
| XLogP | -0.15 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|