C10H28N4 — CID 87393297
2,2-dimethylpropane-1,1-diamine;2,2-dimethylpropane-1,3-diamine (PubChem CID 87393297) has the molecular formula C10H28N4 and a molecular weight of 204.36 g/mol. Its IUPAC name is 2,2-dimethylpropane-1,1-diamine;2,2-dimethylpropane-1,3-diamine.
| Compound Name | 2,2-dimethylpropane-1,1-diamine;2,2-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 87393297 |
| Molecular Formula | C10H28N4 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.23 |
| IUPAC Name | 2,2-dimethylpropane-1,1-diamine;2,2-dimethylpropane-1,3-diamine |
| SMILES | CC(C)(C)C(N)N.CC(C)(CN)CN |
| InChI | InChI=1S/2C5H14N2/c1-5(2,3)4(6)7;1-5(2,3-6)4-7/h4H,6-7H2,1-3H3;3-4,6-7H2,1-2H3 |
| InChIKey | ZOWPRCPKMOLSIW-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|