About [2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 4-methylbenzenesulfonate
[2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 4-methylbenzenesulfonate (PubChem CID 87393442) has the molecular formula C27H24F2O6S3
and a molecular weight of 578.68 g/mol. Its IUPAC name is [2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | [2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 4-methylbenzenesulfonate |
| PubChem CID | 87393442 |
| Molecular Formula | C27H24F2O6S3 |
| Molecular Weight | 578.68 g/mol |
| Exact Mass | 578.07 |
| IUPAC Name | [2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(F)(F)S(=O)(=O)OS(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H24F2O6S3/c1-22-17-19-26(20-18-22)37(30,31)34-21-27(28,29)38(32,33)35-36(23-11-5-2-6-12-23,24-13-7-3-8-14-24)25-15-9-4-10-16-25/h2-20H,21H2,1H3 |
| InChIKey | CIFNAERYBWQFJC-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 578.68 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 4-methylbenzenesulfonate?
The IUPAC name of [2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 4-methylbenzenesulfonate (CID 87393442) is [2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 4-methylbenzenesulfonate.
What is the SMILES notation for [2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 4-methylbenzenesulfonate?
The canonical SMILES for [2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OCC(F)(F)S(=O)(=O)OS(c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of [2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 4-methylbenzenesulfonate?
The InChIKey is CIFNAERYBWQFJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H24F2O6S3/c1-22-17-19-26(20-18-22)37(30,31)34-21-27(28,29)38(32,33)35-36(23-11-5-2-6-12-23,24-13-7-3-8-14-24)25-15-9-4-10-16-25/h2-20H,21H2,1H3.
What are the key properties of [2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 4-methylbenzenesulfonate?
[2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 4-methylbenzenesulfonate has a molecular weight of 578.68 g/mol, XLogP of 6.54, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylethyl] 4-methylbenzenesulfonate is sourced from PubChem (CID 87393442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).