C12H17BrO3 — CID 87393871
2-(2-bromophenyl)acetaldehyde;1,1-dimethoxyethane (PubChem CID 87393871) has the molecular formula C12H17BrO3 and a molecular weight of 289.17 g/mol. Its IUPAC name is 2-(2-bromophenyl)acetaldehyde;1,1-dimethoxyethane.
| Compound Name | 2-(2-bromophenyl)acetaldehyde;1,1-dimethoxyethane |
|---|---|
| PubChem CID | 87393871 |
| Molecular Formula | C12H17BrO3 |
| Molecular Weight | 289.17 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 2-(2-bromophenyl)acetaldehyde;1,1-dimethoxyethane |
| SMILES | COC(C)OC.O=CCc1ccccc1Br |
| InChI | InChI=1S/C8H7BrO.C4H10O2/c9-8-4-2-1-3-7(8)5-6-10;1-4(5-2)6-3/h1-4,6H,5H2;4H,1-3H3 |
| InChIKey | UUTBAGDIVVIANT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.17 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|