C16H11N — CID 87394384
10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-1,3,5,7,9,11,13,15-octaene (PubChem CID 87394384) has the molecular formula C16H11N and a molecular weight of 217.27 g/mol. Its IUPAC name is 10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-1,3,5,7,9,11,13,15-octaene.
| Compound Name | 10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-1,3,5,7,9,11,13,15-octaene |
|---|---|
| PubChem CID | 87394384 |
| Molecular Formula | C16H11N |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-1,3,5,7,9,11,13,15-octaene |
| SMILES | C1=CC2=c3cc4ccccc4nc3=CC(=C1)C2 |
| InChI | InChI=1S/C16H11N/c1-2-7-15-13(5-1)10-14-12-6-3-4-11(8-12)9-16(14)17-15/h1-7,9-10H,8H2 |
| InChIKey | WRVPNCLTHWDFHN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |