C4H4F5I — CID 87394488
1,1,2,3,4-pentafluoro-4-iodobutane (PubChem CID 87394488) has the molecular formula C4H4F5I and a molecular weight of 273.97 g/mol. Its IUPAC name is 1,1,2,3,4-pentafluoro-4-iodobutane.
| Compound Name | 1,1,2,3,4-pentafluoro-4-iodobutane |
|---|---|
| PubChem CID | 87394488 |
| Molecular Formula | C4H4F5I |
| Molecular Weight | 273.97 g/mol |
| Exact Mass | 273.93 |
| IUPAC Name | 1,1,2,3,4-pentafluoro-4-iodobutane |
| SMILES | FC(F)C(F)C(F)C(F)I |
| InChI | InChI=1S/C4H4F5I/c5-1(3(7)8)2(6)4(9)10/h1-4H |
| InChIKey | RAWPXZCTLWMQFG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.97 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|