C14H13F9O3S2 — CID 87394574
(4-tert-butylphenyl)sulfanyl 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 87394574) has the molecular formula C14H13F9O3S2 and a molecular weight of 464.37 g/mol. Its IUPAC name is (4-tert-butylphenyl)sulfanyl 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | (4-tert-butylphenyl)sulfanyl 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 87394574 |
| Molecular Formula | C14H13F9O3S2 |
| Molecular Weight | 464.37 g/mol |
| Exact Mass | 464.02 |
| IUPAC Name | (4-tert-butylphenyl)sulfanyl 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | CC(C)(C)c1ccc(SOS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H13F9O3S2/c1-10(2,3)8-4-6-9(7-5-8)27-26-28(24,25)14(22,23)12(17,18)11(15,16)13(19,20)21/h4-7H,1-3H3 |
| InChIKey | LWVNFKISSCIRAQ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.37 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|