C23H21F5N6O2 — CID 87394604
4-[(3,5-difluorophenyl)methylamino]-6-[4-[2-[(2,2,2-trifluoroacetyl)amino]ethylamino]anilino]pyridine-3-carboxamide (PubChem CID 87394604) has the molecular formula C23H21F5N6O2 and a molecular weight of 508.45 g/mol. Its IUPAC name is 4-[(3,5-difluorophenyl)methylamino]-6-[4-[2-[(2,2,2-trifluoroacetyl)amino]ethylamino]anilino]pyridine-3-carboxamide.
| Compound Name | 4-[(3,5-difluorophenyl)methylamino]-6-[4-[2-[(2,2,2-trifluoroacetyl)amino]ethylamino]anilino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 87394604 |
| Molecular Formula | C23H21F5N6O2 |
| Molecular Weight | 508.45 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | 4-[(3,5-difluorophenyl)methylamino]-6-[4-[2-[(2,2,2-trifluoroacetyl)amino]ethylamino]anilino]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cnc(Nc2ccc(NCCNC(=O)C(F)(F)F)cc2)cc1NCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C23H21F5N6O2/c24-14-7-13(8-15(25)9-14)11-32-19-10-20(33-12-18(19)21(29)35)34-17-3-1-16(2-4-17)30-5-6-31-22(36)23(26,27)28/h1-4,7-10,12,30H,5-6,11H2,(H2,29,35)(H,31,36)(H2,32,33,34) |
| InChIKey | DJQDAZAKOUJVAF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 121.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|