About 2-prop-2-ynyl-5-(3,3,3-trifluoropropylsulfonylmethyl)oxolane
2-prop-2-ynyl-5-(3,3,3-trifluoropropylsulfonylmethyl)oxolane (PubChem CID 87394741) has the molecular formula C11H15F3O3S
and a molecular weight of 284.30 g/mol. Its IUPAC name is 2-prop-2-ynyl-5-(3,3,3-trifluoropropylsulfonylmethyl)oxolane.
Molecular Properties
| Compound Name | 2-prop-2-ynyl-5-(3,3,3-trifluoropropylsulfonylmethyl)oxolane |
| PubChem CID | 87394741 |
| Molecular Formula | C11H15F3O3S |
| Molecular Weight | 284.30 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 2-prop-2-ynyl-5-(3,3,3-trifluoropropylsulfonylmethyl)oxolane |
| SMILES | C#CCC1CCC(CS(=O)(=O)CCC(F)(F)F)O1 |
| InChI | InChI=1S/C11H15F3O3S/c1-2-3-9-4-5-10(17-9)8-18(15,16)7-6-11(12,13)14/h1,9-10H,3-8H2 |
| InChIKey | CPQOZSOMNXMOFV-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-2-ynyl-5-(3,3,3-trifluoropropylsulfonylmethyl)oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-2-ynyl-5-(3,3,3-trifluoropropylsulfonylmethyl)oxolane?
The IUPAC name of 2-prop-2-ynyl-5-(3,3,3-trifluoropropylsulfonylmethyl)oxolane (CID 87394741) is 2-prop-2-ynyl-5-(3,3,3-trifluoropropylsulfonylmethyl)oxolane.
What is the SMILES notation for 2-prop-2-ynyl-5-(3,3,3-trifluoropropylsulfonylmethyl)oxolane?
The canonical SMILES for 2-prop-2-ynyl-5-(3,3,3-trifluoropropylsulfonylmethyl)oxolane is C#CCC1CCC(CS(=O)(=O)CCC(F)(F)F)O1.
What is the InChIKey of 2-prop-2-ynyl-5-(3,3,3-trifluoropropylsulfonylmethyl)oxolane?
The InChIKey is CPQOZSOMNXMOFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F3O3S/c1-2-3-9-4-5-10(17-9)8-18(15,16)7-6-11(12,13)14/h1,9-10H,3-8H2.
What are the key properties of 2-prop-2-ynyl-5-(3,3,3-trifluoropropylsulfonylmethyl)oxolane?
2-prop-2-ynyl-5-(3,3,3-trifluoropropylsulfonylmethyl)oxolane has a molecular weight of 284.30 g/mol, XLogP of 1.92, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-2-ynyl-5-(3,3,3-trifluoropropylsulfonylmethyl)oxolane is sourced from PubChem (CID 87394741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).