C29H31F3N4O4 — CID 87395039
[(3R)-1-[(6-amino-2-pyridinyl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate;2,2,2-trifluoroacetate (PubChem CID 87395039) has the molecular formula C29H31F3N4O4 and a molecular weight of 556.59 g/mol. Its IUPAC name is [(3R)-1-[(6-amino-2-pyridinyl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate;2,2,2-trifluoroacetate.
| Compound Name | [(3R)-1-[(6-amino-2-pyridinyl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87395039 |
| Molecular Formula | C29H31F3N4O4 |
| Molecular Weight | 556.59 g/mol |
| Exact Mass | 556.23 |
| IUPAC Name | [(3R)-1-[(6-amino-2-pyridinyl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate;2,2,2-trifluoroacetate |
| SMILES | Nc1cccc(C[N+]23CCC(CC2)[C@@H](OC(=O)C(Nc2ccccc2)c2ccccc2)C3)n1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C27H31N4O2.C2HF3O2/c28-25-13-7-12-23(29-25)18-31-16-14-20(15-17-31)24(19-31)33-27(32)26(21-8-3-1-4-9-21)30-22-10-5-2-6-11-22;3-2(4,5)1(6)7/h1-13,20,24,26,30H,14-19H2,(H2,28,29);(H,6,7)/q+1;/p-1/t20?,24-,26?,31?;/m0./s1 |
| InChIKey | CKSXIAZVXMCEST-AUJOTONCSA-M |
| XLogP | 3.47 |
| TPSA | 117.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.59 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|