About methyl prop-2-enoate;hydrate
methyl prop-2-enoate;hydrate (PubChem CID 87395112) has the molecular formula C4H8O3
and a molecular weight of 104.10 g/mol. Its IUPAC name is methyl prop-2-enoate;hydrate.
Molecular Properties
| Compound Name | methyl prop-2-enoate;hydrate |
| PubChem CID | 87395112 |
| Molecular Formula | C4H8O3 |
| Molecular Weight | 104.10 g/mol |
| Exact Mass | 104.05 |
| IUPAC Name | methyl prop-2-enoate;hydrate |
| SMILES | C=CC(=O)OC.O |
| InChI | InChI=1S/C4H6O2.H2O/c1-3-4(5)6-2;/h3H,1H2,2H3;1H2 |
| InChIKey | ZOSSPMWRLDTUKE-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 57.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.10 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl prop-2-enoate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl prop-2-enoate;hydrate?
The IUPAC name of methyl prop-2-enoate;hydrate (CID 87395112) is methyl prop-2-enoate;hydrate.
What is the SMILES notation for methyl prop-2-enoate;hydrate?
The canonical SMILES for methyl prop-2-enoate;hydrate is C=CC(=O)OC.O.
What is the InChIKey of methyl prop-2-enoate;hydrate?
The InChIKey is ZOSSPMWRLDTUKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O2.H2O/c1-3-4(5)6-2;/h3H,1H2,2H3;1H2.
What are the key properties of methyl prop-2-enoate;hydrate?
methyl prop-2-enoate;hydrate has a molecular weight of 104.10 g/mol, XLogP of -0.48, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl prop-2-enoate;hydrate is sourced from PubChem (CID 87395112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).