C17H18F3N3O4 — CID 87395363
2,2,2-trifluoro-N-(6'-nitro-2'-oxo-1'-pentylspiro[cyclopropane-1,3'-indole]-5'-yl)acetamide (PubChem CID 87395363) has the molecular formula C17H18F3N3O4 and a molecular weight of 385.34 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(6'-nitro-2'-oxo-1'-pentylspiro[cyclopropane-1,3'-indole]-5'-yl)acetamide.
| Compound Name | 2,2,2-trifluoro-N-(6'-nitro-2'-oxo-1'-pentylspiro[cyclopropane-1,3'-indole]-5'-yl)acetamide |
|---|---|
| PubChem CID | 87395363 |
| Molecular Formula | C17H18F3N3O4 |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 2,2,2-trifluoro-N-(6'-nitro-2'-oxo-1'-pentylspiro[cyclopropane-1,3'-indole]-5'-yl)acetamide |
| SMILES | CCCCCN1C(=O)C2(CC2)c2cc(NC(=O)C(F)(F)F)c([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C17H18F3N3O4/c1-2-3-4-7-22-12-9-13(23(26)27)11(21-14(24)17(18,19)20)8-10(12)16(5-6-16)15(22)25/h8-9H,2-7H2,1H3,(H,21,24) |
| InChIKey | UKHPBEXLYBNACB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|