C20H19F3N4O3 — CID 87395791
[[3-[(4-methoxyphenyl)methyl]-6,7,8,9-tetrahydropyrazolo[3,4-c]isoquinolin-7-yl]amino] 2,2,2-trifluoroacetate (PubChem CID 87395791) has the molecular formula C20H19F3N4O3 and a molecular weight of 420.39 g/mol. Its IUPAC name is [[3-[(4-methoxyphenyl)methyl]-6,7,8,9-tetrahydropyrazolo[3,4-c]isoquinolin-7-yl]amino] 2,2,2-trifluoroacetate.
| Compound Name | [[3-[(4-methoxyphenyl)methyl]-6,7,8,9-tetrahydropyrazolo[3,4-c]isoquinolin-7-yl]amino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87395791 |
| Molecular Formula | C20H19F3N4O3 |
| Molecular Weight | 420.39 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | [[3-[(4-methoxyphenyl)methyl]-6,7,8,9-tetrahydropyrazolo[3,4-c]isoquinolin-7-yl]amino] 2,2,2-trifluoroacetate |
| SMILES | COc1ccc(Cn2ncc3c4c(cnc32)CC(NOC(=O)C(F)(F)F)CC4)cc1 |
| InChI | InChI=1S/C20H19F3N4O3/c1-29-15-5-2-12(3-6-15)11-27-18-17(10-25-27)16-7-4-14(8-13(16)9-24-18)26-30-19(28)20(21,22)23/h2-3,5-6,9-10,14,26H,4,7-8,11H2,1H3 |
| InChIKey | NOMGCCLANCRKOR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|