About trimethylazanium;trimethyl(oxido)silane
trimethylazanium;trimethyl(oxido)silane (PubChem CID 87396208) has the molecular formula C6H19NOSi
and a molecular weight of 149.31 g/mol. Its IUPAC name is trimethylazanium;trimethyl(oxido)silane.
Molecular Properties
| Compound Name | trimethylazanium;trimethyl(oxido)silane |
| PubChem CID | 87396208 |
| Molecular Formula | C6H19NOSi |
| Molecular Weight | 149.31 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | trimethylazanium;trimethyl(oxido)silane |
| SMILES | C[NH+](C)C.C[Si](C)(C)[O-] |
| InChI | InChI=1S/C3H9N.C3H9OSi/c1-4(2)3;1-5(2,3)4/h1-3H3;1-3H3/q;-1/p+1 |
| InChIKey | RXDMBGMRPICAHI-UHFFFAOYSA-O |
| XLogP | -1.06 |
| TPSA | 27.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.31 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethylazanium;trimethyl(oxido)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethylazanium;trimethyl(oxido)silane?
The IUPAC name of trimethylazanium;trimethyl(oxido)silane (CID 87396208) is trimethylazanium;trimethyl(oxido)silane.
What is the SMILES notation for trimethylazanium;trimethyl(oxido)silane?
The canonical SMILES for trimethylazanium;trimethyl(oxido)silane is C[NH+](C)C.C[Si](C)(C)[O-].
What is the InChIKey of trimethylazanium;trimethyl(oxido)silane?
The InChIKey is RXDMBGMRPICAHI-UHFFFAOYSA-O. The full InChI is InChI=1S/C3H9N.C3H9OSi/c1-4(2)3;1-5(2,3)4/h1-3H3;1-3H3/q;-1/p+1.
What are the key properties of trimethylazanium;trimethyl(oxido)silane?
trimethylazanium;trimethyl(oxido)silane has a molecular weight of 149.31 g/mol, XLogP of -1.06, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trimethylazanium;trimethyl(oxido)silane is sourced from PubChem (CID 87396208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).