About (Z)-3,16-dimethyloctadec-9-en-1-amine
(Z)-3,16-dimethyloctadec-9-en-1-amine (PubChem CID 87396265) has the molecular formula C20H41N
and a molecular weight of 295.55 g/mol. Its IUPAC name is (Z)-3,16-dimethyloctadec-9-en-1-amine.
Molecular Properties
| Compound Name | (Z)-3,16-dimethyloctadec-9-en-1-amine |
| PubChem CID | 87396265 |
| Molecular Formula | C20H41N |
| Molecular Weight | 295.55 g/mol |
| Exact Mass | 295.32 |
| IUPAC Name | (Z)-3,16-dimethyloctadec-9-en-1-amine |
| SMILES | CCC(C)CCCCC/C=C\CCCCCC(C)CCN |
| InChI | InChI=1S/C20H41N/c1-4-19(2)15-13-11-9-7-5-6-8-10-12-14-16-20(3)17-18-21/h5-6,19-20H,4,7-18,21H2,1-3H3/b6-5- |
| InChIKey | ZZPGFDMWKXXEGN-WAYWQWQTSA-N |
| XLogP | 6.47 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 295.55 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3,16-dimethyloctadec-9-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3,16-dimethyloctadec-9-en-1-amine?
The IUPAC name of (Z)-3,16-dimethyloctadec-9-en-1-amine (CID 87396265) is (Z)-3,16-dimethyloctadec-9-en-1-amine.
What is the SMILES notation for (Z)-3,16-dimethyloctadec-9-en-1-amine?
The canonical SMILES for (Z)-3,16-dimethyloctadec-9-en-1-amine is CCC(C)CCCCC/C=C\CCCCCC(C)CCN.
What is the InChIKey of (Z)-3,16-dimethyloctadec-9-en-1-amine?
The InChIKey is ZZPGFDMWKXXEGN-WAYWQWQTSA-N. The full InChI is InChI=1S/C20H41N/c1-4-19(2)15-13-11-9-7-5-6-8-10-12-14-16-20(3)17-18-21/h5-6,19-20H,4,7-18,21H2,1-3H3/b6-5-.
What are the key properties of (Z)-3,16-dimethyloctadec-9-en-1-amine?
(Z)-3,16-dimethyloctadec-9-en-1-amine has a molecular weight of 295.55 g/mol, XLogP of 6.47, 15 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3,16-dimethyloctadec-9-en-1-amine is sourced from PubChem (CID 87396265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).