About 2,4-dimethyl-3-sulfanylidenecyclohexa-1,5-diene-1-sulfonyl chloride
2,4-dimethyl-3-sulfanylidenecyclohexa-1,5-diene-1-sulfonyl chloride (PubChem CID 87397004) has the molecular formula C8H9ClO2S2
and a molecular weight of 236.75 g/mol. Its IUPAC name is 2,4-dimethyl-3-sulfanylidenecyclohexa-1,5-diene-1-sulfonyl chloride.
Molecular Properties
| Compound Name | 2,4-dimethyl-3-sulfanylidenecyclohexa-1,5-diene-1-sulfonyl chloride |
| PubChem CID | 87397004 |
| Molecular Formula | C8H9ClO2S2 |
| Molecular Weight | 236.75 g/mol |
| Exact Mass | 235.97 |
| IUPAC Name | 2,4-dimethyl-3-sulfanylidenecyclohexa-1,5-diene-1-sulfonyl chloride |
| SMILES | CC1=C(S(=O)(=O)Cl)C=CC(C)C1=S |
| InChI | InChI=1S/C8H9ClO2S2/c1-5-3-4-7(13(9,10)11)6(2)8(5)12/h3-5H,1-2H3 |
| InChIKey | XPALSBUNUJPMQJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.75 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dimethyl-3-sulfanylidenecyclohexa-1,5-diene-1-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-3-sulfanylidenecyclohexa-1,5-diene-1-sulfonyl chloride?
The IUPAC name of 2,4-dimethyl-3-sulfanylidenecyclohexa-1,5-diene-1-sulfonyl chloride (CID 87397004) is 2,4-dimethyl-3-sulfanylidenecyclohexa-1,5-diene-1-sulfonyl chloride.
What is the SMILES notation for 2,4-dimethyl-3-sulfanylidenecyclohexa-1,5-diene-1-sulfonyl chloride?
The canonical SMILES for 2,4-dimethyl-3-sulfanylidenecyclohexa-1,5-diene-1-sulfonyl chloride is CC1=C(S(=O)(=O)Cl)C=CC(C)C1=S.
What is the InChIKey of 2,4-dimethyl-3-sulfanylidenecyclohexa-1,5-diene-1-sulfonyl chloride?
The InChIKey is XPALSBUNUJPMQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClO2S2/c1-5-3-4-7(13(9,10)11)6(2)8(5)12/h3-5H,1-2H3.
What are the key properties of 2,4-dimethyl-3-sulfanylidenecyclohexa-1,5-diene-1-sulfonyl chloride?
2,4-dimethyl-3-sulfanylidenecyclohexa-1,5-diene-1-sulfonyl chloride has a molecular weight of 236.75 g/mol, XLogP of 2.40, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-3-sulfanylidenecyclohexa-1,5-diene-1-sulfonyl chloride is sourced from PubChem (CID 87397004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).