C16H32N2O10P2 — CID 87397547
[16-diazo-7-(phosphonomethyl)-1,4,10,13-tetraoxacyclooctadec-7-yl]methylphosphonic acid (PubChem CID 87397547) has the molecular formula C16H32N2O10P2 and a molecular weight of 474.38 g/mol. Its IUPAC name is [16-diazo-7-(phosphonomethyl)-1,4,10,13-tetraoxacyclooctadec-7-yl]methylphosphonic acid.
| Compound Name | [16-diazo-7-(phosphonomethyl)-1,4,10,13-tetraoxacyclooctadec-7-yl]methylphosphonic acid |
|---|---|
| PubChem CID | 87397547 |
| Molecular Formula | C16H32N2O10P2 |
| Molecular Weight | 474.38 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | [16-diazo-7-(phosphonomethyl)-1,4,10,13-tetraoxacyclooctadec-7-yl]methylphosphonic acid |
| SMILES | [N-]=[N+]=C1CCOCCOCCC(CP(=O)(O)O)(CP(=O)(O)O)CCOCCOCC1 |
| InChI | InChI=1S/C16H32N2O10P2/c17-18-15-1-5-25-9-11-27-7-3-16(13-29(19,20)21,14-30(22,23)24)4-8-28-12-10-26-6-2-15/h1-14H2,(H2,19,20,21)(H2,22,23,24) |
| InChIKey | MPQGPWPFSRMPJR-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 188.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.38 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|