About (Z)-1-[(Z)-1,2-difluoroethenoxy]-1,2-difluoroethene
(Z)-1-[(Z)-1,2-difluoroethenoxy]-1,2-difluoroethene (PubChem CID 87397929) has the molecular formula C4H2F4O
and a molecular weight of 142.05 g/mol. Its IUPAC name is (Z)-1-[(Z)-1,2-difluoroethenoxy]-1,2-difluoroethene.
Molecular Properties
| Compound Name | (Z)-1-[(Z)-1,2-difluoroethenoxy]-1,2-difluoroethene |
| PubChem CID | 87397929 |
| Molecular Formula | C4H2F4O |
| Molecular Weight | 142.05 g/mol |
| Exact Mass | 142.00 |
| IUPAC Name | (Z)-1-[(Z)-1,2-difluoroethenoxy]-1,2-difluoroethene |
| SMILES | F/C=C(\F)O/C(F)=C/F |
| InChI | InChI=1S/C4H2F4O/c5-1-3(7)9-4(8)2-6/h1-2H/b3-1+,4-2+ |
| InChIKey | IMGRJRMWYWDMFH-ZPUQHVIOSA-N |
| XLogP | 2.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.05 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-[(Z)-1,2-difluoroethenoxy]-1,2-difluoroethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-[(Z)-1,2-difluoroethenoxy]-1,2-difluoroethene?
The IUPAC name of (Z)-1-[(Z)-1,2-difluoroethenoxy]-1,2-difluoroethene (CID 87397929) is (Z)-1-[(Z)-1,2-difluoroethenoxy]-1,2-difluoroethene.
What is the SMILES notation for (Z)-1-[(Z)-1,2-difluoroethenoxy]-1,2-difluoroethene?
The canonical SMILES for (Z)-1-[(Z)-1,2-difluoroethenoxy]-1,2-difluoroethene is F/C=C(\F)O/C(F)=C/F.
What is the InChIKey of (Z)-1-[(Z)-1,2-difluoroethenoxy]-1,2-difluoroethene?
The InChIKey is IMGRJRMWYWDMFH-ZPUQHVIOSA-N. The full InChI is InChI=1S/C4H2F4O/c5-1-3(7)9-4(8)2-6/h1-2H/b3-1+,4-2+.
What are the key properties of (Z)-1-[(Z)-1,2-difluoroethenoxy]-1,2-difluoroethene?
(Z)-1-[(Z)-1,2-difluoroethenoxy]-1,2-difluoroethene has a molecular weight of 142.05 g/mol, XLogP of 2.48, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-[(Z)-1,2-difluoroethenoxy]-1,2-difluoroethene is sourced from PubChem (CID 87397929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).