About [5,6-bis(methoxycarbonyl)-3-pyridinyl]methyl-trimethylazanium bromide
[5,6-bis(methoxycarbonyl)-3-pyridinyl]methyl-trimethylazanium bromide (PubChem CID 87397956) has the molecular formula C13H19BrN2O4
and a molecular weight of 347.21 g/mol. Its IUPAC name is [5,6-bis(methoxycarbonyl)-3-pyridinyl]methyl-trimethylazanium bromide.
Molecular Properties
| Compound Name | [5,6-bis(methoxycarbonyl)-3-pyridinyl]methyl-trimethylazanium bromide |
| PubChem CID | 87397956 |
| Molecular Formula | C13H19BrN2O4 |
| Molecular Weight | 347.21 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | [5,6-bis(methoxycarbonyl)-3-pyridinyl]methyl-trimethylazanium bromide |
| SMILES | COC(=O)c1cc(C[N+](C)(C)C)cnc1C(=O)OC.[Br-] |
| InChI | InChI=1S/C13H19N2O4.BrH/c1-15(2,3)8-9-6-10(12(16)18-4)11(14-7-9)13(17)19-5;/h6-7H,8H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | HPXLXXVNESZDSQ-UHFFFAOYSA-M |
| XLogP | -2.13 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.21 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [5,6-bis(methoxycarbonyl)-3-pyridinyl]methyl-trimethylazanium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5,6-bis(methoxycarbonyl)-3-pyridinyl]methyl-trimethylazanium bromide?
The IUPAC name of [5,6-bis(methoxycarbonyl)-3-pyridinyl]methyl-trimethylazanium bromide (CID 87397956) is [5,6-bis(methoxycarbonyl)-3-pyridinyl]methyl-trimethylazanium bromide.
What is the SMILES notation for [5,6-bis(methoxycarbonyl)-3-pyridinyl]methyl-trimethylazanium bromide?
The canonical SMILES for [5,6-bis(methoxycarbonyl)-3-pyridinyl]methyl-trimethylazanium bromide is COC(=O)c1cc(C[N+](C)(C)C)cnc1C(=O)OC.[Br-].
What is the InChIKey of [5,6-bis(methoxycarbonyl)-3-pyridinyl]methyl-trimethylazanium bromide?
The InChIKey is HPXLXXVNESZDSQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H19N2O4.BrH/c1-15(2,3)8-9-6-10(12(16)18-4)11(14-7-9)13(17)19-5;/h6-7H,8H2,1-5H3;1H/q+1;/p-1.
What are the key properties of [5,6-bis(methoxycarbonyl)-3-pyridinyl]methyl-trimethylazanium bromide?
[5,6-bis(methoxycarbonyl)-3-pyridinyl]methyl-trimethylazanium bromide has a molecular weight of 347.21 g/mol, XLogP of -2.13, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5,6-bis(methoxycarbonyl)-3-pyridinyl]methyl-trimethylazanium bromide is sourced from PubChem (CID 87397956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).