About chloroform;dichloro(difluoro)methane
chloroform;dichloro(difluoro)methane (PubChem CID 87397962) has the molecular formula C2HCl5F2
and a molecular weight of 240.29 g/mol. Its IUPAC name is chloroform;dichloro(difluoro)methane.
Molecular Properties
| Compound Name | chloroform;dichloro(difluoro)methane |
| PubChem CID | 87397962 |
| Molecular Formula | C2HCl5F2 |
| Molecular Weight | 240.29 g/mol |
| Exact Mass | 237.85 |
| IUPAC Name | chloroform;dichloro(difluoro)methane |
| SMILES | ClC(Cl)Cl.FC(F)(Cl)Cl |
| InChI | InChI=1S/CHCl3.CCl2F2/c2-1(3)4;2-1(3,4)5/h1H; |
| InChIKey | KECUUHCRKONAJN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.29 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chloroform;dichloro(difluoro)methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroform;dichloro(difluoro)methane?
The IUPAC name of chloroform;dichloro(difluoro)methane (CID 87397962) is chloroform;dichloro(difluoro)methane.
What is the SMILES notation for chloroform;dichloro(difluoro)methane?
The canonical SMILES for chloroform;dichloro(difluoro)methane is ClC(Cl)Cl.FC(F)(Cl)Cl.
What is the InChIKey of chloroform;dichloro(difluoro)methane?
The InChIKey is KECUUHCRKONAJN-UHFFFAOYSA-N. The full InChI is InChI=1S/CHCl3.CCl2F2/c2-1(3)4;2-1(3,4)5/h1H;.
What are the key properties of chloroform;dichloro(difluoro)methane?
chloroform;dichloro(difluoro)methane has a molecular weight of 240.29 g/mol, XLogP of 4.00, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloroform;dichloro(difluoro)methane is sourced from PubChem (CID 87397962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).