C21H22FN5O7 — CID 87398279
(4'S,6'R,7'R)-17'-fluoro-N-methoxy-N,4',6'-trimethyl-2,4,6-trioxospiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-13'-carboxamide (PubChem CID 87398279) has the molecular formula C21H22FN5O7 and a molecular weight of 475.43 g/mol. Its IUPAC name is (4'S,6'R,7'R)-17'-fluoro-N-methoxy-N,4',6'-trimethyl-2,4,6-trioxospiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-13'-carboxamide.
| Compound Name | (4'S,6'R,7'R)-17'-fluoro-N-methoxy-N,4',6'-trimethyl-2,4,6-trioxospiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-13'-carboxamide |
|---|---|
| PubChem CID | 87398279 |
| Molecular Formula | C21H22FN5O7 |
| Molecular Weight | 475.43 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | (4'S,6'R,7'R)-17'-fluoro-N-methoxy-N,4',6'-trimethyl-2,4,6-trioxospiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-13'-carboxamide |
| SMILES | CON(C)C(=O)c1noc2c(F)c3c(cc12)CC1(C(=O)NC(=O)NC1=O)[C@@H]1[C@@H](C)O[C@@H](C)CN31 |
| InChI | InChI=1S/C21H22FN5O7/c1-8-7-27-14-10(5-11-13(17(28)26(3)32-4)25-34-15(11)12(14)22)6-21(16(27)9(2)33-8)18(29)23-20(31)24-19(21)30/h5,8-9,16H,6-7H2,1-4H3,(H2,23,24,29,30,31)/t8-,9+,16-/m0/s1 |
| InChIKey | FBKPPECDFYCCNX-DRTKUVKGSA-N |
| XLogP | 0.49 |
| TPSA | 143.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.43 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|