About 2-[dimethyl(2-methylprop-2-enyl)silyl]-N,N-dimethylethanamine
2-[dimethyl(2-methylprop-2-enyl)silyl]-N,N-dimethylethanamine (PubChem CID 87398390) has the molecular formula C10H23NSi
and a molecular weight of 185.39 g/mol. Its IUPAC name is 2-[dimethyl(2-methylprop-2-enyl)silyl]-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-[dimethyl(2-methylprop-2-enyl)silyl]-N,N-dimethylethanamine |
| PubChem CID | 87398390 |
| Molecular Formula | C10H23NSi |
| Molecular Weight | 185.39 g/mol |
| Exact Mass | 185.16 |
| IUPAC Name | 2-[dimethyl(2-methylprop-2-enyl)silyl]-N,N-dimethylethanamine |
| SMILES | C=C(C)C[Si](C)(C)CCN(C)C |
| InChI | InChI=1S/C10H23NSi/c1-10(2)9-12(5,6)8-7-11(3)4/h1,7-9H2,2-6H3 |
| InChIKey | PSVNZMXORLPTLU-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[dimethyl(2-methylprop-2-enyl)silyl]-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[dimethyl(2-methylprop-2-enyl)silyl]-N,N-dimethylethanamine?
The IUPAC name of 2-[dimethyl(2-methylprop-2-enyl)silyl]-N,N-dimethylethanamine (CID 87398390) is 2-[dimethyl(2-methylprop-2-enyl)silyl]-N,N-dimethylethanamine.
What is the SMILES notation for 2-[dimethyl(2-methylprop-2-enyl)silyl]-N,N-dimethylethanamine?
The canonical SMILES for 2-[dimethyl(2-methylprop-2-enyl)silyl]-N,N-dimethylethanamine is C=C(C)C[Si](C)(C)CCN(C)C.
What is the InChIKey of 2-[dimethyl(2-methylprop-2-enyl)silyl]-N,N-dimethylethanamine?
The InChIKey is PSVNZMXORLPTLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23NSi/c1-10(2)9-12(5,6)8-7-11(3)4/h1,7-9H2,2-6H3.
What are the key properties of 2-[dimethyl(2-methylprop-2-enyl)silyl]-N,N-dimethylethanamine?
2-[dimethyl(2-methylprop-2-enyl)silyl]-N,N-dimethylethanamine has a molecular weight of 185.39 g/mol, XLogP of 2.83, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[dimethyl(2-methylprop-2-enyl)silyl]-N,N-dimethylethanamine is sourced from PubChem (CID 87398390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).