C33H24F3N11O5S2 — CID 87399319
[7-(6-methoxy-3-pyridinyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl] trifluoromethanesulfonate;7-(6-methoxy-3-pyridinyl)-N-[4-(thiadiazol-4-yl)phenyl]pyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 87399319) has the molecular formula C33H24F3N11O5S2 and a molecular weight of 775.75 g/mol. Its IUPAC name is [7-(6-methoxy-3-pyridinyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl] trifluoromethanesulfonate;7-(6-methoxy-3-pyridinyl)-N-[4-(thiadiazol-4-yl)phenyl]pyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | [7-(6-methoxy-3-pyridinyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl] trifluoromethanesulfonate;7-(6-methoxy-3-pyridinyl)-N-[4-(thiadiazol-4-yl)phenyl]pyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 87399319 |
| Molecular Formula | C33H24F3N11O5S2 |
| Molecular Weight | 775.75 g/mol |
| Exact Mass | 775.14 |
| IUPAC Name | [7-(6-methoxy-3-pyridinyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl] trifluoromethanesulfonate;7-(6-methoxy-3-pyridinyl)-N-[4-(thiadiazol-4-yl)phenyl]pyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | COc1ccc(-c2ccc3cnc(Nc4ccc(-c5csnn5)cc4)nn23)cn1.COc1ccc(-c2ccc3cnc(OS(=O)(=O)C(F)(F)F)nn23)cn1 |
| InChI | InChI=1S/C20H15N7OS.C13H9F3N4O4S/c1-28-19-9-4-14(10-21-19)18-8-7-16-11-22-20(25-27(16)18)23-15-5-2-13(3-6-15)17-12-29-26-24-17;1-23-11-5-2-8(6-17-11)10-4-3-9-7-18-12(19-20(9)10)24-25(21,22)13(14,15)16/h2-12H,1H3,(H,23,25);2-7H,1H3 |
| InChIKey | IACKOELPMVAMGF-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 185.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.75 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|